|
CAS#: 15914-23-5 Product: 1,2-Dimethylchrysene No suppilers available for the product. |
| Name | 1,2-Dimethylchrysene |
|---|---|
| Synonyms | Brn 2558522; Chrysene, 1,2-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C20H16 |
| Molecular Weight | 256.35 |
| CAS Registry Number | 15914-23-5 |
| SMILES | C3=C1C4=C(C=CC1=C2C=CC=CC2=C3)C(=C(C)C=C4)C |
| InChI | 1S/C20H16/c1-13-7-9-18-16(14(13)2)11-12-19-17-6-4-3-5-15(17)8-10-20(18)19/h3-12H,1-2H3 |
| InChIKey | DSPSZYVTOBHKHQ-UHFFFAOYSA-N |
| Density | 1.143g/cm3 (Cal.) |
|---|---|
| Boiling point | 466.474°C at 760 mmHg (Cal.) |
| Flash point | 229.115°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Dimethylchrysene |