Online Database of Chemicals from Around the World
|
CAS#: 52171-92-3 Product: 1,11-Dimethylchrysene No suppilers available for the product. |
| Name | 1,11-Dimethylchrysene |
|---|---|
| Synonyms | 5,7-Dimethylchrysene; Chrysene, 1,11-Dimethyl- |
| Molecular Structure |  |
| Molecular Formula | C20H16 |
| Molecular Weight | 256.35 |
| CAS Registry Number | 52171-92-3 |
| SMILES | C1=C(C2=C(C=C1)C3=C(C(=C2)C)C4=C(C=C3)C=CC=C4)C |
| InChI | 1S/C20H16/c1-13-6-5-9-17-18-11-10-15-7-3-4-8-16(15)20(18)14(2)12-19(13)17/h3-12H,1-2H3 |
| InChIKey | HCLIIKXGJGYUBQ-UHFFFAOYSA-N |
| Density | 1.143g/cm3 (Cal.) |
|---|---|
| Boiling point | 460.19°C at 760 mmHg (Cal.) |
| Flash point | 225.362°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,11-Dimethylchrysene |