Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 7-Ethoxy-1H-Pyrazolo[5,1-c][1,2,4]Thiadiazine 2,2-Dioxide |
|---|---|
| Synonyms | 7-ethoxy-1H-pyrazolo[5,1-c][1,2,4]thiadiazine 2,2-dioxide |
| Molecular Structure | ![CAS#: 143413-54-1， 7-Ethoxy-1H-Pyrazolo[5,1-c][1,2,4]Thiadiazine 2,2-Dioxide](/moreStructures/143413-54-1.gif) |
| Molecular Formula | C7H9N3O3S |
| Molecular Weight | 215.23 |
| CAS Registry Number | 143413-54-1 |
| SMILES | CCOc1cc2n(n1)C=CS(=O)(=O)N2 |
| InChI | 1S/C7H9N3O3S/c1-2-13-7-5-6-9-14(11,12)4-3-10(6)8-7/h3-5,9H,2H2,1H3 |
| InChIKey | GITHSXVMARXRDQ-UHFFFAOYSA-N |
| Density | 1.601g/cm3 (Cal.) |
|---|---|
| Boiling point | 272.006°C at 760 mmHg (Cal.) |
| Flash point | 118.306°C (Cal.) |
| Refractive index | 1.679 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Ethoxy-1H-Pyrazolo[5,1-c][1,2,4]Thiadiazine 2,2-Dioxide |