Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 6-Ethoxy-1H-Pyrazolo[3,4-b]Quinoline |
|---|---|
| Synonyms | 6-ethoxy-1H-pyrazolo[3,4-b]quinoline |
| Molecular Structure | ![CAS#: 485335-60-2， 6-Ethoxy-1H-Pyrazolo[3,4-b]Quinoline](/moreStructures/485335-60-2.gif) |
| Molecular Formula | C12H11N3O |
| Molecular Weight | 213.24 |
| CAS Registry Number | 485335-60-2 |
| SMILES | CCOc1ccc2c(c1)cc-3cnnc3[nH]2 |
| InChI | 1S/C12H11N3O/c1-2-16-10-3-4-11-8(6-10)5-9-7-13-15-12(9)14-11/h3-7H,2H2,1H3,(H,13,14,15) |
| InChIKey | GHBKZDUKORBQBL-UHFFFAOYSA-N |
| Density | 1.333g/cm3 (Cal.) |
|---|---|
| Boiling point | 366.7°C at 760 mmHg (Cal.) |
| Flash point | 175.574°C (Cal.) |
| Refractive index | 1.681 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Ethoxy-1H-Pyrazolo[3,4-b]Quinoline |