Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-Ethoxy-5H-Pyridazino[4,5-b]Indole |
|---|---|
| Synonyms | 4-ethoxy-5H-pyridazino[4,5-b]indole |
| Molecular Structure | ![CAS#: 383412-06-4， 4-Ethoxy-5H-Pyridazino[4,5-b]Indole](/moreStructures/383412-06-4.gif) |
| Molecular Formula | C12H11N3O |
| Molecular Weight | 213.24 |
| CAS Registry Number | 383412-06-4 |
| SMILES | CCOc1c2c(cnn1)c3ccccc3[nH]2 |
| InChI | 1S/C12H11N3O/c1-2-16-12-11-9(7-13-15-12)8-5-3-4-6-10(8)14-11/h3-7,14H,2H2,1H3 |
| InChIKey | KFOZMTYLCOOMSX-UHFFFAOYSA-N |
| Density | 1.309g/cm3 (Cal.) |
|---|---|
| Boiling point | 497.207°C at 760 mmHg (Cal.) |
| Flash point | 176.608°C (Cal.) |
| Refractive index | 1.713 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Ethoxy-5H-Pyridazino[4,5-b]Indole |