Online Database of Chemicals from Around the World
|
CAS#: 14548-01-7 Product: Phenanthridine5-Oxide No suppilers available for the product. |
| Name | Phenanthridine5-Oxide |
|---|---|
| Synonyms | 5-Oxidephenanthridine; Nsc 263827; Phenanthridine, 5-Oxide (8Ci)(9Ci) |
| Molecular Structure |  |
| Molecular Formula | C13H9NO |
| Molecular Weight | 195.22 |
| CAS Registry Number | 14548-01-7 |
| SMILES | C1=CC=CC2=C1[N+](=CC3=CC=CC=C23)[O-] |
| InChI | 1S/C13H9NO/c15-14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-9H |
| InChIKey | BSGIEESBTVXEOH-UHFFFAOYSA-N |
| Density | 1.188g/cm3 (Cal.) |
|---|---|
| Boiling point | 408.912°C at 760 mmHg (Cal.) |
| Flash point | 201.103°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenanthridine5-Oxide |