Online Database of Chemicals from Around the World
| Glentham Life Sciences | UK | Inquire | ||
|---|---|---|---|---|
 |
+44 (2033) 978-798 | |||
 |
info@glenthamls.com | |||
| Chemical distributor since 2013 | ||||
| Name | Phenanthridin-6-Amine |
|---|---|
| Synonyms | 6-Phenanthridinamine; Phenanthridin-6-Ylamine; Phenanthridine, 6-Amino- |
| Molecular Structure |  |
| Molecular Formula | C13H10N2 |
| Molecular Weight | 194.24 |
| CAS Registry Number | 832-68-8 |
| SMILES | C2=CC=CC3=C1C=CC=CC1=C(N)N=C23 |
| InChI | 1S/C13H10N2/c14-13-11-7-2-1-5-9(11)10-6-3-4-8-12(10)15-13/h1-8H,(H2,14,15) |
| InChIKey | FVCXJXKLDUJOFA-UHFFFAOYSA-N |
| Density | 1.268g/cm3 (Cal.) |
|---|---|
| Boiling point | 406.442°C at 760 mmHg (Cal.) |
| Flash point | 228.611°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Phenanthridin-6-Amine |