Online Database of Chemicals from Around the World
|
CAS#: 23702-49-0 Product: 5-Phenanthro(4,5-bcd)Pyran-5-One No suppilers available for the product. |
| Name | 5-Phenanthro(4,5-bcd)Pyran-5-One |
|---|---|
| Synonyms | 5H-Phenanthro(4,5-Bcd)Pyran-5-One; Ccris 2211; 4-Oxapyrene-5-One |
| Molecular Structure |  |
| Molecular Formula | C15H8O2 |
| Molecular Weight | 220.23 |
| CAS Registry Number | 23702-49-0 |
| SMILES | C2=CC1=CC=CC4=C1C3=C(C=CC=C23)C(O4)=O |
| InChI | 1S/C15H8O2/c16-15-11-5-1-3-9-7-8-10-4-2-6-12(17-15)14(10)13(9)11/h1-8H |
| InChIKey | SJXDHZGVKPNCHK-UHFFFAOYSA-N |
| Density | 1.407g/cm3 (Cal.) |
|---|---|
| Boiling point | 435.609°C at 760 mmHg (Cal.) |
| Flash point | 184.233°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Phenanthro(4,5-bcd)Pyran-5-One |