Online Database of Chemicals from Around the World
|
CAS#: 149990-50-1 Product: Ocobullenone No suppilers available for the product. |
| Name | Ocobullenone |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C21H22O6 |
| Molecular Weight | 370.40 |
| CAS Registry Number | 149990-50-1 |
| SMILES | [C@@]13([C@H]([C@@H](C)[C@@]2(C1)OCOC2=CC3=O)C5=CC(=C4OCOC4=C5)OC)CC=C |
| InChI | 1S/C21H22O6/c1-4-5-20-9-21(17(8-16(20)22)25-11-27-21)12(2)18(20)13-6-14(23-3)19-15(7-13)24-10-26-19/h4,6-8,12,18H,1,5,9-11H2,2-3H3/t12-,18-,20+,21-/m1/s1 |
| InChIKey | VMBFNOIPGQFDTB-XFHMVGKKSA-N |
| Density | 1.338g/cm3 (Cal.) |
|---|---|
| Boiling point | 510.191°C at 760 mmHg (Cal.) |
| Flash point | 224.021°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ocobullenone |