Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 3-Chloro-4-Methylphenyl Methyl Cyanocarbonodithioimidate |
|---|---|
| Synonyms | (3-Chloro-4-methylphenyl) methyl; (3-Chloro-4-methylphenyl) methylcyanocarbonimidodithioate; cyanocarbonimidodithioate |
| Molecular Structure |  |
| Molecular Formula | C10H9ClN2S2 |
| Molecular Weight | 256.77 |
| CAS Registry Number | 152382-24-6 |
| SMILES | Clc1cc(S\C(=N\C#N)SC)ccc1C |
| InChI | 1S/C10H9ClN2S2/c1-7-3-4-8(5-9(7)11)15-10(14-2)13-6-12/h3-5H,1-2H3/b13-10+ |
| InChIKey | LWFPMTNZBQYNNC-JLHYYAGUSA-N |
| Density | 1.264g/cm3 (Cal.) |
|---|---|
| Boiling point | 385.327°C at 760 mmHg (Cal.) |
| Flash point | 186.84°C (Cal.) |
| Refractive index | 1.615 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chloro-4-Methylphenyl Methyl Cyanocarbonodithioimidate |