Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | N-[[4-(Chloromethyl)Phenyl]Methyl]Acrylamide |
|---|---|
| Synonyms | N-[4-(Chloromethyl)Benzyl]Acrylamide; N-((4-(Chloromethyl)Phenyl)Methyl)Acrylamide |
| Molecular Structure | ![CAS#: 84787-85-9， N-[[4-(Chloromethyl)Phenyl]Methyl]Acrylamide](/moreStructures/84787-85-9.gif) |
| Molecular Formula | C11H12ClNO |
| Molecular Weight | 209.67 |
| CAS Registry Number | 84787-85-9 |
| EINECS | 284-126-3 |
| SMILES | C1=C(CCl)C=CC(=C1)CNC(=O)C=C |
| InChI | 1S/C11H12ClNO/c1-2-11(14)13-8-10-5-3-9(7-12)4-6-10/h2-6H,1,7-8H2,(H,13,14) |
| InChIKey | KBMXUXBJBNFPRO-UHFFFAOYSA-N |
| Density | 1.14g/cm3 (Cal.) |
|---|---|
| Boiling point | 413.326°C at 760 mmHg (Cal.) |
| Flash point | 203.772°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[[4-(Chloromethyl)Phenyl]Methyl]Acrylamide |