Online Database of Chemicals from Around the World
|
CAS#: 2589-65-3 Product: (4-Chloro-3-Methylphenyl) N-Methylcarbamate No suppilers available for the product. |
| Name | (4-Chloro-3-Methylphenyl) N-Methylcarbamate |
|---|---|
| Synonyms | (4-Chloro-3-Methyl-Phenyl) N-Methylcarbamate; N-Methylcarbamic Acid (4-Chloro-3-Methylphenyl) Ester; N-Methylcarbamic Acid (4-Chloro-3-Methyl-Phenyl) Ester |
| Molecular Structure |  |
| Molecular Formula | C9H10ClNO2 |
| Molecular Weight | 199.64 |
| CAS Registry Number | 2589-65-3 |
| SMILES | C1=C(C=CC(=C1C)Cl)OC(NC)=O |
| InChI | 1S/C9H10ClNO2/c1-6-5-7(3-4-8(6)10)13-9(12)11-2/h3-5H,1-2H3,(H,11,12) |
| InChIKey | CWOGPWIJFSPUMU-UHFFFAOYSA-N |
| Density | 1.216g/cm3 (Cal.) |
|---|---|
| Boiling point | 277.185°C at 760 mmHg (Cal.) |
| Flash point | 121.437°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4-Chloro-3-Methylphenyl) N-Methylcarbamate |