Online Database of Chemicals from Around the World
|
CAS#: 15285-42-4 Product: Benzyl Nitrate No suppilers available for the product. |
| Name | Benzyl Nitrate |
|---|---|
| Synonyms | nitric acid benzyl ester; nitrooxymethyl-benzene |
| Molecular Structure |  |
| Molecular Formula | C7H7NO3 |
| Molecular Weight | 153.14 |
| CAS Registry Number | 15285-42-4 |
| SMILES | C1=CC=C(C=C1)CO[N+](=O)[O-] |
| InChI | 1S/C7H7NO3/c9-8(10)11-6-7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | WOIVNLSVAKYSKX-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 236.8±19.0°C at 760 mmHg (Cal.) |
| Flash point | 113.8±23.5°C (Cal.) |
| Refractive index | 1.536 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzyl Nitrate |