Online Database of Chemicals from Around the World
|
CAS#: 15301-45-8 Product: Antafenite No suppilers available for the product. |
| Name | Antafenite |
|---|---|
| Synonyms | 6-Phenyl-5,6-Dihydroimidazo[2,1-B]Thiazole; ( -)-5,6-Dihydro-6-Phenylimidazo(2,1-B)Thiazole; Antafenite |
| Molecular Structure |  |
| Molecular Formula | C11H10N2S |
| Molecular Weight | 202.27 |
| CAS Registry Number | 15301-45-8 |
| SMILES | C3=C(C2CN1C=CSC1=N2)C=CC=C3 |
| InChI | 1S/C11H10N2S/c1-2-4-9(5-3-1)10-8-13-6-7-14-11(13)12-10/h1-7,10H,8H2 |
| InChIKey | UPMCDOMOBNMTPH-UHFFFAOYSA-N |
| Density | 1.313g/cm3 (Cal.) |
|---|---|
| Boiling point | 347.853°C at 760 mmHg (Cal.) |
| Flash point | 164.176°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Antafenite |