Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Princeton BioMolecular Research, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (732) 355-9920 | |||
|
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | Ethyl 2'-Methoxy-4-Biphenylcarboxylate |
|---|---|
| Synonyms | 2'-Methoxy-biphenyl-4-carboxylic acid ethyl ester; ethyl 2'-methoxy-1,1'-biphenyl-4-carboxylate |
| Molecular Structure |  |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 |
| CAS Registry Number | 155061-60-2 |
| SMILES | CCOC(=O)c1ccc(cc1)c2ccccc2OC |
| InChI | 1S/C16H16O3/c1-3-19-16(17)13-10-8-12(9-11-13)14-6-4-5-7-15(14)18-2/h4-11H,3H2,1-2H3 |
| InChIKey | JUYLQXVUOXQETO-UHFFFAOYSA-N |
| Density | 1.099g/cm3 (Cal.) |
|---|---|
| Boiling point | 356.821°C at 760 mmHg (Cal.) |
| Flash point | 148.735°C (Cal.) |
| Refractive index | 1.547 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 2'-Methoxy-4-Biphenylcarboxylate |