Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Ethyl (2'-Methoxy-3-Biphenylyl)Acetate |
|---|---|
| Synonyms | (2'-Methoxy-biphenyl-3-yl)-acetic acid ethyl ester; [1,1'-BIPHENYL]-3-ACETICACID, 2'-METHOXY-, ETHYL ESTER; ETHYL(2-METHOXY-BIPHENYL-3-YL)-ACETATE |
| Molecular Structure |  |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.32 |
| CAS Registry Number | 187270-16-2 |
| SMILES | CCOC(=O)Cc1cccc(c1)c2ccccc2OC |
| InChI | 1S/C17H18O3/c1-3-20-17(18)12-13-7-6-8-14(11-13)15-9-4-5-10-16(15)19-2/h4-11H,3,12H2,1-2H3 |
| InChIKey | LDERXAIJKAWVIH-UHFFFAOYSA-N |
| Density | 1.09g/cm3 (Cal.) |
|---|---|
| Boiling point | 360.233°C at 760 mmHg (Cal.) |
| Flash point | 150.346°C (Cal.) |
| Refractive index | 1.542 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl (2'-Methoxy-3-Biphenylyl)Acetate |