Online Database of Chemicals from Around the World
| Princeton BioMolecular Research, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (732) 355-9920 | |||
 |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Rare Chemicals GmbH | Germany | Inquire | ||
|---|---|---|---|---|
|
+49 (431) 5606-600 | |||
|
info@rarechem.de | |||
| Chemical manufacturer since 1997 | ||||
| Name | Ethyl 2'-methoxy-2-biphenylcarboxylate |
|---|---|
| Synonyms | 2'-Methoxy-biphenyl-2-carboxylic acid ethyl ester; ethyl 2'-methoxy-1,1'-biphenyl-2-carboxylate |
| Molecular Structure |  |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 |
| CAS Registry Number | 773139-83-6 |
| SMILES | O=C(OCC)c2c(c1ccccc1OC)cccc2 |
| InChI | 1S/C16H16O3/c1-3-19-16(17)14-10-5-4-8-12(14)13-9-6-7-11-15(13)18-2/h4-11H,3H2,1-2H3 |
| InChIKey | VKHABGIDXXJCFK-UHFFFAOYSA-N |
| Density | 1.099g/cm3 (Cal.) |
|---|---|
| Boiling point | 365.218°C at 760 mmHg (Cal.) |
| Flash point | 152.702°C (Cal.) |
| Refractive index | 1.547 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 2'-methoxy-2-biphenylcarboxylate |