| Zhengzhou Kingorgchem Chemical Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.kingorgchem.com | |||
![]() | +86 (371) 6551-1006 | |||
![]() | +86 (371) 6575-6965 | |||
![]() | sales@kingorgchem.com | |||
![]() | QQ Chat | |||
![]() | WeChat: 18625597674 | |||
| Chemical manufacturer since 2015 | ||||
| chemBlink Standard supplier since 2016 | ||||
| Zhengzhou Changkuan Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.changkuantech.com | |||
![]() | +86 (371) 6376-9919 +86 18530983798 | |||
![]() | +86 (371) 6360-3986 | |||
![]() | sales5@changkuantech.com | |||
![]() | QQ Chat | |||
| Chemical manufacturer since 2012 | ||||
| chemBlink Standard supplier since 2016 | ||||
| Shanghai Fuxin Pharmaceutical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.fuxinpharm.com | |||
![]() | +86 (21) 3130-0828 +86 18645121291 | |||
![]() | +86 (21) 3130-0828 | |||
![]() | contact@fuxinpharm.com | |||
| Chemical manufacturer since 2016 | ||||
| chemBlink Standard supplier since 2018 | ||||
| Classification | Organic raw materials >> Organic phosphine compound |
|---|---|
| Name | (1S)-1-(Diphenylphosphino)-2-[(1R)-1-(diphenylphosphino)ethyl]ferrocene |
| Synonyms | (1Rp)-1-(Diphenylphosphino)-2-[(1R)-1-(diphenylphosphino)ethyl]ferrocene |
| Molecular Structure | ![]() |
| Molecular Formula | C36H32FeP2 |
| Molecular Weight | 582.43 |
| CAS Registry Number | 155941-31-4 |
| SMILES | C[C@H](C1CCCC1P(C2=CC=CC=C2)C3=CC=CC=C3)P(C4=CC=CC=C4)C5=CC=CC=C5.C1CCCC1.[Fe] |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H315-H319-H335 Details |
| Safety Statements | P280-P305+P351+P338 Details |
| SDS | Available |
|
(1S)-1-(Diphenylphosphino)-2-[(1R)-1-(diphenylphosphino)ethyl]ferrocene, often referred to simply as a ferrocene-based phosphine ligand, is a noteworthy compound in the realm of organometallic chemistry and catalysis. Its discovery and applications highlight the versatility and significance of chiral phosphine ligands in various chemical processes. The compound is a chiral ferrocene derivative where the ferrocene moiety is substituted with two diphenylphosphino groups, one at the 1-position and another at the 2-position on the cyclopentadienyl rings. The additional chiral (1R)-1-(diphenylphosphino)ethyl group introduces asymmetry into the structure, creating a ligand with distinct stereochemical properties. This stereochemistry is crucial for its role in asymmetric catalysis, where the precise control of molecular orientation can lead to selective reactions and high enantioselectivity. The discovery of this ligand stemmed from the broader search for effective chiral ligands in asymmetric synthesis. Traditional phosphine ligands often lacked the required enantioselectivity or stability, prompting researchers to explore new structural frameworks. Ferrocene, with its robust and versatile nature, was chosen as a backbone due to its ability to stabilize various functional groups while providing a platform for introducing chiral centers. One of the primary applications of (1S)-1-(Diphenylphosphino)-2-[(1R)-1-(diphenylphosphino)ethyl]ferrocene is in asymmetric catalysis. This ligand is employed in catalytic reactions that require high selectivity and efficiency, such as in the synthesis of chiral pharmaceuticals and fine chemicals. Its ability to induce chirality in catalytic processes makes it valuable for producing enantiomerically pure compounds, which is critical in the pharmaceutical industry where the efficacy and safety of drugs often depend on their stereochemistry. In addition to asymmetric catalysis, the ligand is used in various other catalytic transformations, including cross-coupling reactions and hydrosilylation. Its strong coordination ability and electronic properties make it a versatile tool in designing efficient catalytic systems. The stability and reactivity of the ferrocene core, combined with the chiral phosphine groups, contribute to its effectiveness in these applications. The development and application of (1S)-1-(Diphenylphosphino)-2-[(1R)-1-(diphenylphosphino)ethyl]ferrocene underscore the importance of chiral ligands in modern synthetic chemistry. By enhancing the selectivity and efficiency of catalytic processes, this compound plays a crucial role in advancing chemical synthesis and materials science. References none |
| Market Analysis Reports |
| List of Reports Available for (1S)-1-(Diphenylphosphino)-2-[(1R)-1-(diphenylphosphino)ethyl]ferrocene |