Online Database of Chemicals from Around the World
(2E)-1,1,1,2,3,4,4,5,5,6,6,7,7,7-Tetradecafluoro-2-Heptene
[CAS# 1582-32-7]
Identification
| Name |
(2E)-1,1,1,2,3,4,4,5,5,6,6,7,7,7-Tetradecafluoro-2-Heptene |
|---|
| Synonyms |
MFCD03094437; Perfluorohept-2-ene; Perfluoroheptene-2 |
|
| Molecular Structure |
 |
| Molecular Formula |
C7F14 |
| Molecular Weight |
350.05 |
| CAS Registry Number |
1582-32-7 |
| SMILES |
FC(F)(C(F)(F)C(F)(F)F)C(F)(F)C(/F)=C(\F)C(F)(F)F |
| InChI |
1S/C7F14/c8-1(2(9)4(12,13)14)3(10,11)5(15,16)6(17,18)7(19,20)21/b2-1+ |
| InChIKey |
UGHJWZHBCXGSAY-OWOJBTEDSA-N |
|
Properties
| Density |
1.637g/cm3 (Cal.) |
|---|
|
1.5 (Expl.) |
| Boiling point |
78-84°C (Expl.) |
|
89.286°C at 760 mmHg (Cal.) |
| Flash point |
17.33°C (Cal.) |
| Refractive index |
1.271 (Cal.) |
|
Safety Data
| Safety Description |
S23,S24/25,S36/37/39,S45 |
|---|
|
R36/37/38 |
|
Irritant |
| SDS |
Available |
|
| Market Analysis Reports |
|
List of Reports Available for (2E)-1,1,1,2,3,4,4,5,5,6,6,7,7,7-Tetradecafluoro-2-Heptene
|
|
|
Related Products
1,13-Tetradecad... (Z,Z)-Tetradeca... (3Z,5E)-3,5-Tet... 3,11-Tetradecad... 5,9-Tetradecadi... 5,7-Tetradecadi... Tetradecaethoxy... 1,2,2,3,4,4,6,6... 1,1,1,2,2,5,5,6... 1,1,2,2,3,3,4,4... Tetradecafluoro... 2,2,3,3,4,4,5,5... 2,2,3,3,4,4,5,5... 1,1,1,2,2,3,3,7... 2,2,3,3,4,4,5,5... 2,2,3,3,4,4,5,5... Tetradecafluoro... 3,3',3'',3''',3... 2,2,3,3,4,4,5,5... 3-[(1Z,3Z,5Z,7Z...
