Online Database of Chemicals from Around the World
|
CAS#: 36481-20-6 Product: 1,2,2,3,4,4,6,6,8,8,9,9,10,10-Tetradecafluoro-5,7-Bis(Trifluoromethyl)Adamantane No suppilers available for the product. |
| Name | 1,2,2,3,4,4,6,6,8,8,9,9,10,10-Tetradecafluoro-5,7-Bis(Trifluoromethyl)Adamantane |
|---|---|
| Synonyms | Perfluoro-1,3-Dimethyladamantane; Tricyclo[3.3.1.1(3,7)]Decane, 1,2,2,3,4,4,6,6,8,8,9,9,10,10-Tetradecafluoro-5,7-Bis(Trifluoromethyl)-; 1,2,2,3,4,4,6,6,8,8,9,9,10,10-Tetradecafluoro-5,7-Bis(Trifluoromethyl)Tricyclo(3.3.1.1(3,7))Decane |
| Molecular Structure |  |
| Molecular Formula | C12F20 |
| Molecular Weight | 524.10 |
| CAS Registry Number | 36481-20-6 |
| SMILES | FC13C(F)(F)C2(C(F)(F)C(C1(F)F)(C(F)(F)C(F)(C2(F)F)C3(F)F)C(F)(F)F)C(F)(F)F |
| InChI | 1S/C12F20/c13-3-6(17,18)1(11(27,28)29)5(15,16)2(8(3,21)22,12(30,31)32)9(23,24)4(14,7(1,19)20)10(3,25)26 |
| InChIKey | LRMQIJUOLGKFKS-UHFFFAOYSA-N |
| Density | 1.899g/cm3 (Cal.) |
|---|---|
| Boiling point | 129.042°C at 760 mmHg (Cal.) |
| Flash point | 44.625°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,2,3,4,4,6,6,8,8,9,9,10,10-Tetradecafluoro-5,7-Bis(Trifluoromethyl)Adamantane |