Online Database of Chemicals from Around the World
|
CAS#: 15899-31-7 Product: Tetradecafluoroisononanoic Acid No suppilers available for the product. |
| Name | Tetradecafluoroisononanoic Acid |
|---|---|
| Synonyms | 2,2,3,3,4,4,5,5,6,6,7,8,8,8-Tetradecafluoro-7-(Trifluoromethyl)Caprylic Acid; Octanoic Acid, 2,2,3,3,4,4,5,5,6,6,7,8,8,8-Tetradecafluoro-7-(Trifluoromethyl)- |
| Molecular Structure |  |
| Molecular Formula | C9HF17O2 |
| Molecular Weight | 464.08 |
| CAS Registry Number | 15899-31-7 |
| EINECS | 240-036-6 |
| SMILES | O=C(C(C(C(C(C(C(C(F)(F)F)(C(F)(F)F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
| InChI | 1S/C9HF17O2/c10-2(11,1(27)28)4(13,14)6(17,18)7(19,20)5(15,16)3(12,8(21,22)23)9(24,25)26/h(H,27,28) |
| InChIKey | WIXVASFEKZIRFM-UHFFFAOYSA-N |
| Density | 1.753g/cm3 (Cal.) |
|---|---|
| Boiling point | 187.386°C at 760 mmHg (Cal.) |
| Flash point | 67.129°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tetradecafluoroisononanoic Acid |