Online Database of Chemicals from Around the World
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (386) 462-0788 | |||
 |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
|
+44 (845) 299-6009/ | |||
|
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Classification | Organic raw materials >> Organic fluorine compound >> Fluoropropane series |
|---|---|
| Name | 1,2,2-Trichloropentafluoropropane |
| Synonyms | 1,2,2-Trichloro-1,1,3,3,3-Pentafluoro-Propane; 1,2,2-Trichloropentafluoropropane; 3-01-00-00233 (Beilstein Handbook Reference) |
| Molecular Structure |  |
| Molecular Formula | C3Cl3F5 |
| Molecular Weight | 237.38 |
| CAS Registry Number | 1599-41-3 |
| SMILES | ClC(C(F)(F)F)(C(F)(F)Cl)Cl |
| InChI | 1S/C3Cl3F5/c4-1(5,2(6,7)8)3(9,10)11 |
| InChIKey | SFCFZNZZFJRHSD-UHFFFAOYSA-N |
| Density | 1.701g/cm3 (Cal.) |
|---|---|
| Boiling point | 74.444°C at 760 mmHg (Cal.) |
| 72-73°C (Expl.) | |
| Flash point | 4.419°C (Cal.) |
| Refractive index | 1.3499 (Expl.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,2-Trichloropentafluoropropane |