| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Manchester Organics Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | Trichloro(Pentafluorophenyl)Silane |
|---|---|
| Synonyms | (Perfluor |
| Molecular Structure | ![]() |
| Molecular Formula | C6Cl3F5Si |
| Molecular Weight | 301.50 |
| CAS Registry Number | 20083-38-9 |
| SMILES | Fc1c(F)c(F)c(F)c(F)c1[Si](Cl)(Cl)Cl |
| InChI | 1S/C6Cl3F5Si/c7-15(8,9)6-4(13)2(11)1(10)3(12)5(6)14 |
| InChIKey | QUJHWGZPSFBJAP-UHFFFAOYSA-N |
| Density | 1.637g/cm3 (Cal.) |
|---|---|
| Boiling point | 193.864°C at 760 mmHg (Cal.) |
| 85°C (Expl.) | |
| Flash point | 71.047°C (Cal.) |
| 71°C (Expl.) | |
| Refractive index | 1.461 (Cal.) |
| Safety Description | S26,S27,S36/37/39,S45 |
|---|---|
| Corrosive | |
| Corrosive/reacts violently with water/flammable | |
| R14,R34 | |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Trichloro(Pentafluorophenyl)Silane |