Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1,1,3-Trichloropentafluoropropane |
|---|---|
| Synonyms | 1,1,3-Trichloro-1,2,2,3,3-Pentafluoro-Propane; Poly(Difluoromethylene), Alpha-Chloro-Omega-(2,2-Dichloro-1,1,2-Trifluoroethyl)- |
| Molecular Structure |  |
| Molecular Formula | C3Cl3F5 |
| Molecular Weight | 237.38 |
| CAS Registry Number | 1652-81-9 |
| EINECS | 216-718-4 |
| SMILES | ClC(C(C(F)(Cl)Cl)(F)F)(F)F |
| InChI | 1S/C3Cl3F5/c4-2(5,9)1(7,8)3(6,10)11 |
| InChIKey | PSVOCRUYXNEMNE-UHFFFAOYSA-N |
| Density | 1.701g/cm3 (Cal.) |
|---|---|
| Boiling point | 73.778°C at 760 mmHg (Cal.) |
| Flash point | 4.045°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,3-Trichloropentafluoropropane |