Online Database of Chemicals from Around the World
| Florida Center for Heterocyclic Compounds | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (352) 392-0554 | |||
 |
katritzky@chem.ufl.edu | |||
| Chemical manufacturer | ||||
| Name | 4,4'-Dichloroazobenzene |
|---|---|
| Synonyms | Bis-(4-Chloro-Phenyl)-Diazene; Diazene, Bis(4-Chlorophenyl)-; Brn 0745559 |
| Molecular Formula | C12H8Cl2N2 |
| Molecular Weight | 251.11 |
| CAS Registry Number | 1602-00-2 |
| SMILES | C1=CC(=CC=C1N=NC2=CC=C(C=C2)Cl)Cl |
| InChI | 1S/C12H8Cl2N2/c13-9-1-5-11(6-2-9)15-16-12-7-3-10(14)4-8-12/h1-8H |
| InChIKey | XHQLXCFUPJSGOE-UHFFFAOYSA-N |
| Density | 1.276g/cm3 (Cal.) |
|---|---|
| Boiling point | 375.219°C at 760 mmHg (Cal.) |
| Flash point | 180.726°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4,4'-Dichloroazobenzene |