Online Database of Chemicals from Around the World
|
CAS#: 139-24-2 Product: 3,3'-Dichloroazoxybenzene No suppilers available for the product. |
| Name | 3,3'-Dichloroazoxybenzene |
|---|---|
| Synonyms | (3-Chlorophenyl)-(3-Chlorophenyl)Imino-Oxido-Ammonium; (3-Chlorophenyl)-(3-Chlorophenyl)Imino-Oxidoammonium; (3-Chlorophenyl)-(3-Chlorophenyl)Imino-Oxido-Azanium |
| Molecular Structure |  |
| Molecular Formula | C12H8Cl2N2O |
| Molecular Weight | 267.11 |
| CAS Registry Number | 139-24-2 |
| SMILES | C2=C([N-][N+](=O)C1=CC(=CC=C1)Cl)C=CC=C2Cl |
| InChI | 1S/C12H8Cl2N2O/c13-9-3-1-5-11(7-9)15-16(17)12-6-2-4-10(14)8-12/h1-8H |
| InChIKey | SXCDGVDBGGCCLV-UHFFFAOYSA-N |
| Density | 1.334g/cm3 (Cal.) |
|---|---|
| Boiling point | 415.157°C at 760 mmHg (Cal.) |
| Flash point | 204.88°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3'-Dichloroazoxybenzene |