Online Database of Chemicals from Around the World
| Princeton BioMolecular Research, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (732) 355-9920 | |||
 |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | 1,8-Diethoxy-9,10-Anthraquinone |
|---|---|
| Synonyms | 1,8-Diethoxyanthra-9,10-quinone #; 1,8-diethoxyanthracene-9,10-dione |
| Molecular Structure |  |
| Molecular Formula | C18H16O4 |
| Molecular Weight | 296.32 |
| CAS Registry Number | 16294-26-1 |
| SMILES | O=C2c1cccc(OCC)c1C(=O)c3c2cccc3OCC |
| InChI | 1S/C18H16O4/c1-3-21-13-9-5-7-11-15(13)18(20)16-12(17(11)19)8-6-10-14(16)22-4-2/h5-10H,3-4H2,1-2H3 |
| InChIKey | JUJCDDMVGAFUTI-UHFFFAOYSA-N |
| Density | 1.234g/cm3 (Cal.) |
|---|---|
| Boiling point | 479.131°C at 760 mmHg (Cal.) |
| Flash point | 213.365°C (Cal.) |
| Refractive index | 1.592 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,8-Diethoxy-9,10-Anthraquinone |