Online Database of Chemicals from Around the World
|
CAS#: 22924-22-7 Product: 1,5-Diethoxyanthraquinone No suppilers available for the product. |
| Name | 1,5-Diethoxyanthraquinone |
|---|---|
| Synonyms | 1,5-Diethoxy-9,10-Anthraquinone; 9,10-Anthracenedione, 1,5-Diethoxy-; Anthraquinone, 1,5-Diethoxy- |
| Molecular Structure |  |
| Molecular Formula | C18H16O4 |
| Molecular Weight | 296.32 |
| CAS Registry Number | 22924-22-7 |
| SMILES | C3=CC2=C(C(C1=C(C(=CC=C1)OCC)C2=O)=O)C(=C3)OCC |
| InChI | 1S/C18H16O4/c1-3-21-13-9-5-7-11-15(13)17(19)12-8-6-10-14(22-4-2)16(12)18(11)20/h5-10H,3-4H2,1-2H3 |
| InChIKey | RRRRZDVJLWPWII-UHFFFAOYSA-N |
| Density | 1.234g/cm3 (Cal.) |
|---|---|
| Boiling point | 479.131°C at 760 mmHg (Cal.) |
| Flash point | 213.365°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,5-Diethoxyanthraquinone |