| Henan Ouber Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.oubertec.com | |||
![]() | +86 (371) 6532-2607 +86 18937141980 | |||
![]() | +86 (371) 6532-2607 | |||
![]() | anna.zhang@oubertec.com | |||
![]() | QQ Chat | |||
![]() | WeChat: 18937141980 | |||
| Chemical manufacturer since 2020 | ||||
| chemBlink Standard supplier since 2020 | ||||
| Name | N-(2,4-Dinitrophenyl)-L-tryptophan |
|---|---|
| Synonyms | (2S)-2-(2,4-dinitroanilino)-3-(1H-indol-3-yl)propanoic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C17H14N4O6 |
| Molecular Weight | 370.32 |
| CAS Registry Number | 1655-51-2 |
| EC Number | 216-738-3 |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C[C@@H](C(=O)O)NC3=C(C=C(C=C3)[N+](=O)[O-])[N+](=O)[O-] |
| Solubility | 18.38 mg/L (25 °C water) |
|---|---|
| Density | 1.6±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.763, Calc.* |
| Melting point | 252.37 °C |
| Boiling Point | 699.6±55.0 °C (760 mmHg), Calc.*, 585.15 °C |
| Flash Point | 376.9±31.5 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for N-(2,4-Dinitrophenyl)-L-tryptophan |