Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | N,N-Dinitropiperazine |
|---|---|
| Synonyms | 5-23-03-00226 (Beilstein Handbook Reference); Ai3-00500; Brn 0181941 |
| Molecular Structure |  |
| Molecular Formula | C4H8N4O4 |
| Molecular Weight | 176.13 |
| CAS Registry Number | 4164-37-8 |
| EINECS | 224-010-1 |
| SMILES | O=[N+]([O-])N1CCN([N+]([O-])=O)CC1 |
| InChI | 1S/C4H8N4O4/c9-7(10)5-1-2-6(4-3-5)8(11)12/h1-4H2 |
| InChIKey | GSUMZAMXDRIYCL-UHFFFAOYSA-N |
| Density | 1.537g/cm3 (Cal.) |
|---|---|
| Boiling point | 492.195°C at 760 mmHg (Cal.) |
| Flash point | 251.471°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Dinitropiperazine |