| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Tyrosine derivatives |
|---|---|
| Name | O-(2,4-Dinitrophenyl)-L-Tyrosine |
| Synonyms | O-Mono-2,4-Dinitrophenyl-L-Tyrosine; O-MONO-2,4-DNP-L-TYROSINE; O-2,4-DNP-L-TYROSINE |
| Molecular Structure | ![]() |
| Molecular Formula | C15H13N3O7 |
| Molecular Weight | 347.28 |
| CAS Registry Number | 10567-73-4 |
| SMILES | OC(=O)[C@H](Cc1ccc(cc1)Oc1ccc(cc1[N+](=O)[O-])[N+](=O)[O-])N |
| InChI | 1S/C15H13N3O7/c16-12(15(19)20)7-9-1-4-11(5-2-9)25-14-6-3-10(17(21)22)8-13(14)18(23)24/h1-6,8,12H,7,16H2,(H,19,20)/t12-/m0/s1 |
| Market Analysis Reports |
| List of Reports Available for O-(2,4-Dinitrophenyl)-L-Tyrosine |