Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| DSL Chemicals (Shanghai) Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 (21) 6352-9955 | |||
|
info@dsl-chem.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 8-Quinolinol Hydrochloride (1:1) |
|---|---|
| Synonyms | 8-Quinolinol Hydrochloride; Oxine Hydrochloride; 8-Hydroxyquinoline, Hydrochloride |
| Molecular Structure |  |
| Molecular Formula | C9H8ClNO |
| Molecular Weight | 181.62 |
| CAS Registry Number | 16862-11-6 |
| EINECS | 240-884-7 |
| SMILES | [H+].C1=CC=C(O)C2=C1C=CC=N2.[Cl-] |
| InChI | 1S/C9H7NO.ClH/c11-8-5-1-3-7-4-2-6-10-9(7)8;/h1-6,11H;1H |
| InChIKey | GXBJNMSTHMBPPE-UHFFFAOYSA-N |
| Boiling point | 267°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 143.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Quinolinol Hydrochloride (1:1) |