| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 8-Quinolinol Acetate |
|---|---|
| Synonyms | 8-Quinolyl Acetate; Acetic Acid 8-Quinolyl Ester; Quinolin-8-Yl Ethanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.20 |
| CAS Registry Number | 2598-29-0 |
| EINECS | 219-999-1 |
| SMILES | C1=C(C2=C(C=C1)C=CC=N2)OC(=O)C |
| InChI | 1S/C11H9NO2/c1-8(13)14-10-6-2-4-9-5-3-7-12-11(9)10/h2-7H,1H3 |
| InChIKey | MZPCTRNDYNHZQE-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 53-57°C (Expl.) |
| Boiling point | 321.6±15.0°C at 760 mmHg (Cal.) |
| Flash point | 148.3±20.4°C (Cal.) |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
|---|---|
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 8-Quinolinol Acetate |