Online Database of Chemicals from Around the World
| Name | 1-Nitrophenanthrene |
|---|---|
| Synonyms | 4-Nitrophenanthrene; Nitrophenanthrene; Phenanthrene, Nitro- |
| Molecular Structure |  |
| Molecular Formula | C14H9NO2 |
| Molecular Weight | 223.23 |
| CAS Registry Number | 17024-17-8 |
| SMILES | C2=CC1=CC=CC=C1C3=C2C(=CC=C3)[N+]([O-])=O |
| InChI | 1S/C14H9NO2/c16-15(17)14-7-3-6-12-11-5-2-1-4-10(11)8-9-13(12)14/h1-9H |
| InChIKey | SGNWFFATVZVHNF-UHFFFAOYSA-N |
| Density | 1.317g/cm3 (Cal.) |
|---|---|
| Boiling point | 413.279°C at 760 mmHg (Cal.) |
| Flash point | 207.498°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Nitrophenanthrene |
