Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2-Nitro-Phenanthrene |
|---|---|
| Synonyms | 4-05-00-02304 (Beilstein Handbook Reference); Brn 2372743; Ccris 3370 |
| Molecular Structure |  |
| Molecular Formula | C14H9NO2 |
| Molecular Weight | 223.23 |
| CAS Registry Number | 17024-18-9 |
| SMILES | C1=C([N+]([O-])=O)C=CC2=C1C=CC3=CC=CC=C23 |
| InChI | 1S/C14H9NO2/c16-15(17)12-7-8-14-11(9-12)6-5-10-3-1-2-4-13(10)14/h1-9H |
| InChIKey | PYZVVHPEDWRKME-UHFFFAOYSA-N |
| Density | 1.317g/cm3 (Cal.) |
|---|---|
| Boiling point | 423.876°C at 760 mmHg (Cal.) |
| Flash point | 214.685°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Nitro-Phenanthrene |