| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 4-Nitrophenanthrene |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C14H9NO2 |
| Molecular Weight | 223.23 |
| CAS Registry Number | 82064-15-1 |
| SMILES | C1=CC=CC2=C1C3=C(C=C2)C=CC=C3[N+](=O)[O-] |
| InChI | 1S/C14H9NO2/c16-15(17)13-7-3-5-11-9-8-10-4-1-2-6-12(10)14(11)13/h1-9H |
| InChIKey | JMKUZZRDJVZRQZ-UHFFFAOYSA-N |
| Density | 1.317g/cm3 (Cal.) |
|---|---|
| Boiling point | 413.279°C at 760 mmHg (Cal.) |
| Flash point | 207.498°C (Cal.) |
| (1) | M. R. Taylor and M. J. Thompson. 4-Nitrophenanthrene, Acta Cryst. (2001). E57, o9-o10 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-Nitrophenanthrene |