Online Database of Chemicals from Around the World
|
CAS#: 17066-67-0 Product: beta-Selinene No suppilers available for the product. |
| Name | beta-Selinene |
|---|---|
| Synonyms | (4Ar,7R,8As)-7-Isopropenyl-4A-Methyl-1-Methylene-Decalin; (4Ar,7R,8As)-7-Isopropenyl-4A-Methyl-1-Methylenedecalin; .Beta.-Selinene |
| Molecular Structure |  |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35 |
| CAS Registry Number | 17066-67-0 |
| SMILES | [C@]12(C)[C@@H](C[C@@H](CC1)C(C)=C)C(=C)CCC2 |
| InChI | 1S/C15H24/c1-11(2)13-7-9-15(4)8-5-6-12(3)14(15)10-13/h13-14H,1,3,5-10H2,2,4H3/t13-,14+,15-/m1/s1 |
| InChIKey | YOVSPTNQHMDJAG-QLFBSQMISA-N |
| Density | 0.887g/cm3 (Cal.) |
|---|---|
| Boiling point | 262.908°C at 760 mmHg (Cal.) |
| Flash point | 102.238°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for beta-Selinene |