|
CAS#: 473-13-2 Product: alpha-Selinene No suppilers available for the product. |
| Name | alpha-Selinene |
|---|---|
| Synonyms | 3-Isopropenyl-5,8A-Dimethyl-2,3,4,4A,7,8-Hexahydro-1H-Naphthalene; 7-Epi--.Alpha.-Selinene; 7-Epi-.Alpha.-Selinene |
| Molecular Structure | ![]() |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35 |
| CAS Registry Number | 473-13-2 |
| SMILES | CC12C(C(=CCC1)C)CC(CC2)C(=C)C |
| InChI | 1S/C15H24/c1-11(2)13-7-9-15(4)8-5-6-12(3)14(15)10-13/h6,13-14H,1,5,7-10H2,2-4H3 |
| InChIKey | OZQAPQSEYFAMCY-UHFFFAOYSA-N |
| Density | 0.889g/cm3 (Cal.) |
|---|---|
| Boiling point | 269.999°C at 760 mmHg (Cal.) |
| Flash point | 101.959°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-Selinene |