Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| ChemScene LLC | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (732) 484-9848 | |||
|
sales@chemscene.com | |||
| Chemical manufacturer since 2011 | ||||
| Name | 4-Biphenylyl Methyl Carbonate |
|---|---|
| Synonyms | [1,1'-Biphenyl]-4-yl methyl carbonate #; Carbonic acid,[1,1'-biphenyl]-4-yl methyl ester |
| Molecular Structure |  |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.24 |
| CAS Registry Number | 17175-08-5 |
| SMILES | O=C(Oc1ccc(cc1)c2ccccc2)OC |
| InChI | 1S/C14H12O3/c1-16-14(15)17-13-9-7-12(8-10-13)11-5-3-2-4-6-11/h2-10H,1H3 |
| InChIKey | RANTWTKWHLPURZ-UHFFFAOYSA-N |
| Density | 1.149g/cm3 (Cal.) |
|---|---|
| Boiling point | 354.994°C at 760 mmHg (Cal.) |
| Flash point | 139.576°C (Cal.) |
| Refractive index | 1.557 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Biphenylyl Methyl Carbonate |