Online Database of Chemicals from Around the World
|
CAS#: 86412-52-4 Product: N-(4-Biphenylyl)-N-methoxyacetamide No suppilers available for the product. |
| Name | N-(4-Biphenylyl)-N-methoxyacetamide |
|---|---|
| Synonyms | Acetamide, N-[1,1'-biphenyl]-3-yl-N-methoxy-; N-[1,1'-Biphenyl]-4-yl-N-methoxyacetamide # |
| Molecular Structure |  |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 |
| CAS Registry Number | 86412-52-4 |
| SMILES | O=C(N(OC)c1ccc(cc1)c2ccccc2)C |
| InChI | 1S/C15H15NO2/c1-12(17)16(18-2)15-10-8-14(9-11-15)13-6-4-3-5-7-13/h3-11H,1-2H3 |
| InChIKey | LUOWAGZBPAISDY-UHFFFAOYSA-N |
| Density | 1.134g/cm3 (Cal.) |
|---|---|
| Boiling point | 365.257°C at 760 mmHg (Cal.) |
| Flash point | 174.702°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(4-Biphenylyl)-N-methoxyacetamide |