Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 4-Biphenylyl Methacrylate |
|---|---|
| Synonyms | Methacrylic acid, 4-biphenyl ester |
| Molecular Structure |  |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.28 |
| CAS Registry Number | 46904-74-9 |
| SMILES | O=C(Oc1ccc(cc1)c2ccccc2)\C(=C)C |
| InChI | 1S/C16H14O2/c1-12(2)16(17)18-15-10-8-14(9-11-15)13-6-4-3-5-7-13/h3-11H,1H2,2H3 |
| InChIKey | HEJFLAMVALNBRR-UHFFFAOYSA-N |
| Density | 1.082g/cm3 (Cal.) |
|---|---|
| Boiling point | 378.35°C at 760 mmHg (Cal.) |
| Flash point | 158.811°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Biphenylyl Methacrylate |