Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 3,3,4,4,4-Pentafluorobutyl Acrylate |
|---|---|
| Synonyms | Prop-2-Enoic Acid 3,3,4,4,4-Pentafluorobutyl Ester; Acrylic Acid 3,3,4,4,4-Pentafluorobutyl Ester; 1,1,2,2-Tetrahydroperfluorobutyl Acrylate |
| Molecular Structure |  |
| Molecular Formula | C7H7F5O2 |
| Molecular Weight | 218.12 |
| CAS Registry Number | 17527-31-0 |
| EINECS | 241-528-3 |
| SMILES | C(C(C(F)(F)F)(F)F)COC(=O)C=C |
| InChI | 1S/C7H7F5O2/c1-2-5(13)14-4-3-6(8,9)7(10,11)12/h2H,1,3-4H2 |
| InChIKey | AVVYSSRKCWEPBH-UHFFFAOYSA-N |
| Density | 1.283g/cm3 (Cal.) |
|---|---|
| Boiling point | 127.734°C at 760 mmHg (Cal.) |
| Flash point | 37.162°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3,4,4,4-Pentafluorobutyl Acrylate |