Online Database of Chemicals from Around the World
|
CAS#: 52519-51-4 Product: 3,3,4,4,4-Pentafluorobutyl Methacrylate No suppilers available for the product. |
| Name | 3,3,4,4,4-Pentafluorobutyl Methacrylate |
|---|---|
| Synonyms | 2-Methylprop-2-Enoic Acid 3,3,4,4,4-Pentafluorobutyl Ester; 2-Methylacrylic Acid 3,3,4,4,4-Pentafluorobutyl Ester; 2-Propenoic Acid, 2-Methyl-, 3,3,4,4,4-Pentafluorobutyl Ester |
| Molecular Structure |  |
| Molecular Formula | C8H9F5O2 |
| Molecular Weight | 232.15 |
| CAS Registry Number | 52519-51-4 |
| EINECS | 257-990-4 |
| SMILES | C(C(C(F)(F)F)(F)F)COC(=O)C(=C)C |
| InChI | 1S/C8H9F5O2/c1-5(2)6(14)15-4-3-7(9,10)8(11,12)13/h1,3-4H2,2H3 |
| InChIKey | DJMQEXDGIXFVSC-UHFFFAOYSA-N |
| Density | 1.246g/cm3 (Cal.) |
|---|---|
| Boiling point | 151.842°C at 760 mmHg (Cal.) |
| Flash point | 51.041°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3,4,4,4-Pentafluorobutyl Methacrylate |