Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1,2,3,4,5-Pentafluoro-2,4-cyclopentadiene-1-carbonyl fluoride |
|---|---|
| Synonyms | 1,2,3,4,5-pentafluorocyclopenta-2,4-dienecarbonyl fluoride |
| Molecular Structure |  |
| Molecular Formula | C6F6O |
| Molecular Weight | 202.05 |
| CAS Registry Number | 74415-70-6 |
| SMILES | C1(=C(C(C(=C1F)F)(C(=O)F)F)F)F |
| InChI | 1S/C6F6O/c7-1-2(8)4(10)6(12,3(1)9)5(11)13 |
| InChIKey | BSDHWGUZWZLJDB-UHFFFAOYSA-N |
| Density | 1.624g/cm3 (Cal.) |
|---|---|
| Boiling point | 156.718°C at 760 mmHg (Cal.) |
| Flash point | 55.315°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4,5-Pentafluoro-2,4-cyclopentadiene-1-carbonyl fluoride |