Online Database of Chemicals from Around the World
|
CAS#: 17581-86-1 Product: 3'-Hydroxyisosafrole No suppilers available for the product. |
| Name | 3'-Hydroxyisosafrole |
|---|---|
| Synonyms | 2-Propen-1-Ol, 3-(1,3-Benzodioxol-5-Yl)-; 2-Propen-1-Ol, 3-[3,4-(Methylenedioxy)Phenyl]-; Nsc15657 |
| Molecular Structure |  |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 |
| CAS Registry Number | 17581-86-1 |
| SMILES | C1=C(C=CC2=C1OCO2)\C=C/CO |
| InChI | 1S/C10H10O3/c11-5-1-2-8-3-4-9-10(6-8)13-7-12-9/h1-4,6,11H,5,7H2/b2-1- |
| InChIKey | JQZASRHQYJJUCE-UPHRSURJSA-N |
| Density | 1.281g/cm3 (Cal.) |
|---|---|
| Boiling point | 339.96°C at 760 mmHg (Cal.) |
| Flash point | 159.402°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3'-Hydroxyisosafrole |