Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | (3R)-1-hydroxy-3-(isothiocyanatomethyl)-2,2,5,5-tetramethyl-pyrrolidine |
|---|---|
| Synonyms | (3R)-1-Hydroxy-3-(Isothiocyanatomethyl)-2,2,5,5-Tetramethyl-Pyrrolidine; Zinc02539309 |
| Molecular Structure |  |
| Molecular Formula | C10H18N2OS |
| Molecular Weight | 214.33 |
| CAS Registry Number | 78140-52-0 |
| SMILES | S=C=NC[C@@H]1C(N(O)C(C1)(C)C)(C)C |
| InChI | 1S/C10H18N2OS/c1-9(2)5-8(6-11-7-14)10(3,4)12(9)13/h8,13H,5-6H2,1-4H3/t8-/m1/s1 |
| InChIKey | AFWDXCSMXGMRHO-MRVPVSSYSA-N |
| Density | 1.106g/cm3 (Cal.) |
|---|---|
| Boiling point | 321.977°C at 760 mmHg (Cal.) |
| Flash point | 148.527°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3R)-1-hydroxy-3-(isothiocyanatomethyl)-2,2,5,5-tetramethyl-pyrrolidine |