Online Database of Chemicals from Around the World
|
CAS#: 21201-50-3 Product: 2-Hydroxyisoquinolin-1(2H)-One No suppilers available for the product. |
| Name | 2-Hydroxyisoquinolin-1(2H)-One |
|---|---|
| Synonyms | 2-Hydroxy-1-Isoquinolinone; 2-Hydroxyisocarbostyril; 1(2H)-Isoquinolinone, 2-Hydroxy- |
| Molecular Structure |  |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.16 |
| CAS Registry Number | 21201-50-3 |
| SMILES | C1=CC2=C(C=C1)C(=O)N(O)C=C2 |
| InChI | 1S/C9H7NO2/c11-9-8-4-2-1-3-7(8)5-6-10(9)12/h1-6,12H |
| InChIKey | FPDYOSFKYCMRME-UHFFFAOYSA-N |
| Density | 1.412g/cm3 (Cal.) |
|---|---|
| Boiling point | 338.179°C at 760 mmHg (Cal.) |
| Flash point | 158.325°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Hydroxyisoquinolin-1(2H)-One |