Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 4-(1,1,2,3,3,3-Hexafluoropropoxy)Biphenyl |
|---|---|
| Synonyms | 1,1'-Biphenyl, 4-(1,1,2,3,3,3-hexafluoropropoxy)-; 1,1'-BIPHENYL,4-(1,1,2,3,3,3-HEXAFLUOROPROPOXY)-; 4-(1,1,2,3,3,3-Hexafluoropropoxy)biphenyl |
| Molecular Structure |  |
| Molecular Formula | C15H10F6O |
| Molecular Weight | 320.23 |
| CAS Registry Number | 175838-51-4 |
| SMILES | c1ccc(cc1)c2ccc(cc2)OC(C(C(F)(F)F)F)(F)F |
| InChI | 1S/C15H10F6O/c16-13(14(17,18)19)15(20,21)22-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9,13H |
| InChIKey | ZNGNEMNTMTZFTO-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 302.5±42.0°C at 760 mmHg (Cal.) |
| Flash point | 144.5±23.8°C (Cal.) |
| Refractive index | 1.465 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(1,1,2,3,3,3-Hexafluoropropoxy)Biphenyl |