Online Database of Chemicals from Around the World
| Name | 1-Nitropyrene-6-Ol |
|---|---|
| Synonyms | 6-Nitro-1-Pyrenol; 1-Nitro-6-Hydroxypyrene; 1-Nitropyren-6-Ol |
| Molecular Structure |  |
| Molecular Formula | C16H9NO3 |
| Molecular Weight | 263.25 |
| CAS Registry Number | 1767-28-8 |
| SMILES | C1=CC2=CC=C3C(=CC=C4C=CC(=C1O)C2=C34)[N+]([O-])=O |
| InChI | 1S/C16H9NO3/c18-14-8-4-10-1-5-11-13(17(19)20)7-3-9-2-6-12(14)16(10)15(9)11/h1-8,18H |
| InChIKey | MAVZUIFIVMZYMX-UHFFFAOYSA-N |
| Density | 1.528g/cm3 (Cal.) |
|---|---|
| Boiling point | 509.687°C at 760 mmHg (Cal.) |
| Flash point | 218.297°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Nitropyrene-6-Ol |
