|
CAS#: 86674-49-9 Product: 3-Nitro-1-pyrenol No suppilers available for the product. |
| Name | 3-Nitro-1-pyrenol |
|---|---|
| Synonyms | 1-Nitro-3-hydroxypyrene; 1-Nitropyren-3-ol; 1-nitropyrene-3-ol |
| Molecular Structure | ![]() |
| Molecular Formula | C16H9NO3 |
| Molecular Weight | 263.25 |
| CAS Registry Number | 86674-49-9 |
| SMILES | C1=CC2=C3C(=C1)C=CC4=C(C=C(C(=C43)C=C2)[N+](=O)[O-])O |
| InChI | 1S/C16H9NO3/c18-14-8-13(17(19)20)11-6-4-9-2-1-3-10-5-7-12(14)16(11)15(9)10/h1-8,18H |
| InChIKey | BOQCPFGCIYLAGN-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 502.7±33.0°C at 760 mmHg (Cal.) |
| Flash point | 215.3±13.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Nitro-1-pyrenol |